C20H20N+ — CID 22670767
4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-1-methylquinolin-1-ium (PubChem CID 22670767) has the molecular formula C20H20N+ and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-1-methylquinolin-1-ium.
| Compound Name | 4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-1-methylquinolin-1-ium |
|---|---|
| PubChem CID | 22670767 |
| Molecular Formula | C20H20N+ |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4-[(E)-2-(3,4-dimethylphenyl)ethenyl]-1-methylquinolin-1-ium |
| SMILES | Cc1ccc(/C=C/c2cc[n+](C)c3ccccc23)cc1C |
| InChI | InChI=1S/C20H20N/c1-15-8-9-17(14-16(15)2)10-11-18-12-13-21(3)20-7-5-4-6-19(18)20/h4-14H,1-3H3/q+1/b11-10+ |
| InChIKey | PFMNHRMAXDFJPV-ZHACJKMWSA-N |
| XLogP | 4.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|