C27H28Cl2N3O2+ — CID 66963994
(2S)-2-amino-3-(4-hydroxyphenyl)-N-[4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl]propanamide;dihydrochloride (PubChem CID 66963994) has the molecular formula C27H28Cl2N3O2+ and a molecular weight of 497.45 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)-N-[4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl]propanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-[4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 66963994 |
| Molecular Formula | C27H28Cl2N3O2+ |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-[4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl]propanamide;dihydrochloride |
| SMILES | C[n+]1ccc(C=Cc2ccc(NC(=O)[C@@H](N)Cc3ccc(O)cc3)cc2)c2ccccc21.Cl.Cl |
| InChI | InChI=1S/C27H25N3O2.2ClH/c1-30-17-16-21(24-4-2-3-5-26(24)30)11-6-19-7-12-22(13-8-19)29-27(32)25(28)18-20-9-14-23(31)15-10-20;;/h2-17,25,31H,18,28H2,1H3;2*1H/p+1/t25-;;/m0../s1 |
| InChIKey | LVWJZHFLNZWAHV-WLOLSGMKSA-O |
| XLogP | 4.89 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|