C18H19Cl2N — CID 6303998
N,N-bis(2-chloroethyl)-4-[(E)-2-phenylethenyl]aniline (PubChem CID 6303998) has the molecular formula C18H19Cl2N and a molecular weight of 320.26 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-4-[(E)-2-phenylethenyl]aniline.
| Compound Name | N,N-bis(2-chloroethyl)-4-[(E)-2-phenylethenyl]aniline |
|---|---|
| PubChem CID | 6303998 |
| Molecular Formula | C18H19Cl2N |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N,N-bis(2-chloroethyl)-4-[(E)-2-phenylethenyl]aniline |
| SMILES | ClCCN(CCCl)c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19Cl2N/c19-12-14-21(15-13-20)18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h1-11H,12-15H2/b7-6+ |
| InChIKey | UYWMEHDTIRHWEV-VOTSOKGWSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|