C32H30Cl4N4 — CID 141414589
2,5-bis[2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 141414589) has the molecular formula C32H30Cl4N4 and a molecular weight of 612.43 g/mol. Its IUPAC name is 2,5-bis[2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis[2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 141414589 |
| Molecular Formula | C32H30Cl4N4 |
| Molecular Weight | 612.43 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 2,5-bis[2-[4-[bis(2-chloroethyl)amino]phenyl]ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(C=Cc2ccc(N(CCCl)CCCl)cc2)c(C#N)cc1C=Cc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C32H30Cl4N4/c33-13-17-39(18-14-34)31-9-3-25(4-10-31)1-7-27-21-30(24-38)28(22-29(27)23-37)8-2-26-5-11-32(12-6-26)40(19-15-35)20-16-36/h1-12,21-22H,13-20H2 |
| InChIKey | KOKWCJCPBVJQKB-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.43 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|