C81H90N6 — CID 91322161
2,4,6-tris[2-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 91322161) has the molecular formula C81H90N6 and a molecular weight of 1147.65 g/mol. Its IUPAC name is 2,4,6-tris[2-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4,6-tris[2-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 91322161 |
| Molecular Formula | C81H90N6 |
| Molecular Weight | 1147.65 g/mol |
| Exact Mass | 1146.72 |
| IUPAC Name | 2,4,6-tris[2-[4-[2-[4-(dibutylamino)phenyl]ethenyl]phenyl]ethenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | CCCCN(CCCC)c1ccc(C=Cc2ccc(C=Cc3c(C#N)c(C=Cc4ccc(C=Cc5ccc(N(CCCC)CCCC)cc5)cc4)c(C#N)c(C=Cc4ccc(C=Cc5ccc(N(CCCC)CCCC)cc5)cc4)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C81H90N6/c1-7-13-55-85(56-14-8-2)73-46-37-70(38-47-73)34-25-64-19-28-67(29-20-64)43-52-76-79(61-82)77(53-44-68-30-21-65(22-31-68)26-35-71-39-48-74(49-40-71)86(57-15-9-3)58-16-10-4)81(63-84)78(80(76)62-83)54-45-69-32-23-66(24-33-69)27-36-72-41-50-75(51-42-72)87(59-17-11-5)60-18-12-6/h19-54H,7-18,55-60H2,1-6H3 |
| InChIKey | DFIOKPKKXFIFMA-UHFFFAOYSA-N |
| XLogP | 21.54 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.65 |
| LogP ≤ 5 | 21.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|