C36H27N3 — CID 101132259
2,4,6-tris[(E)-2-(4-methylphenyl)ethenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 101132259) has the molecular formula C36H27N3 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2,4,6-tris[(E)-2-(4-methylphenyl)ethenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4,6-tris[(E)-2-(4-methylphenyl)ethenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 101132259 |
| Molecular Formula | C36H27N3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 2,4,6-tris[(E)-2-(4-methylphenyl)ethenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | Cc1ccc(/C=C/c2c(C#N)c(/C=C/c3ccc(C)cc3)c(C#N)c(/C=C/c3ccc(C)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C36H27N3/c1-25-4-10-28(11-5-25)16-19-31-34(22-37)32(20-17-29-12-6-26(2)7-13-29)36(24-39)33(35(31)23-38)21-18-30-14-8-27(3)9-15-30/h4-21H,1-3H3/b19-16+,20-17+,21-18+ |
| InChIKey | YPNCBAJKQAOQPN-VNQRMFGESA-N |
| XLogP | 8.74 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|