C50H40F4N2 — CID 59041372
4-methyl-N-(4-methylphenyl)-N-[4-[2-[2,3,5,6-tetrafluoro-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]aniline (PubChem CID 59041372) has the molecular formula C50H40F4N2 and a molecular weight of 744.88 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[4-[2-[2,3,5,6-tetrafluoro-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[4-[2-[2,3,5,6-tetrafluoro-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59041372 |
| Molecular Formula | C50H40F4N2 |
| Molecular Weight | 744.88 g/mol |
| Exact Mass | 744.31 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[4-[2-[2,3,5,6-tetrafluoro-4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=Cc3c(F)c(F)c(C=Cc4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C50H40F4N2/c1-33-5-19-39(20-6-33)55(40-21-7-34(2)8-22-40)43-27-13-37(14-28-43)17-31-45-47(51)49(53)46(50(54)48(45)52)32-18-38-15-29-44(30-16-38)56(41-23-9-35(3)10-24-41)42-25-11-36(4)12-26-42/h5-32H,1-4H3 |
| InChIKey | JTGUZXGOHDACIA-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.88 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|