C55H46N2S — CID 143060501
4-(4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]anilino)benzenethiol (PubChem CID 143060501) has the molecular formula C55H46N2S and a molecular weight of 767.05 g/mol. Its IUPAC name is 4-(4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]anilino)benzenethiol.
| Compound Name | 4-(4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]anilino)benzenethiol |
|---|---|
| PubChem CID | 143060501 |
| Molecular Formula | C55H46N2S |
| Molecular Weight | 767.05 g/mol |
| Exact Mass | 766.34 |
| IUPAC Name | 4-(4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]anilino)benzenethiol |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(/C=C/c3ccc(-c4ccc(/C=C/c5ccc(N(c6ccc(C)cc6)c6ccc(S)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H46N2S/c1-40-4-26-49(27-5-40)56(50-28-6-41(2)7-29-50)52-32-18-45(19-33-52)12-10-43-14-22-47(23-15-43)48-24-16-44(17-25-48)11-13-46-20-34-53(35-21-46)57(51-30-8-42(3)9-31-51)54-36-38-55(58)39-37-54/h4-39,58H,1-3H3/b12-10+,13-11+ |
| InChIKey | LDHWQWGGQMEFOT-DCIPZJNNSA-N |
| XLogP | 15.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.05 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|