C17H12N2 — CID 67854033
3-[2-(4-methylphenyl)ethenyl]benzene-1,2-dicarbonitrile (PubChem CID 67854033) has the molecular formula C17H12N2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-[2-(4-methylphenyl)ethenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-(4-methylphenyl)ethenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 67854033 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-[2-(4-methylphenyl)ethenyl]benzene-1,2-dicarbonitrile |
| SMILES | Cc1ccc(C=Cc2cccc(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C17H12N2/c1-13-5-7-14(8-6-13)9-10-15-3-2-4-16(11-18)17(15)12-19/h2-10H,1H3 |
| InChIKey | FAVZEIBORGKJQX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|