C24H16N2 — CID 22725864
2,4-bis[(E)-2-phenylethenyl]benzene-1,3-dicarbonitrile (PubChem CID 22725864) has the molecular formula C24H16N2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2,4-bis[(E)-2-phenylethenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 2,4-bis[(E)-2-phenylethenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 22725864 |
| Molecular Formula | C24H16N2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,4-bis[(E)-2-phenylethenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(/C=C/c2ccccc2)c(C#N)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H16N2/c25-17-22-15-14-21(13-11-19-7-3-1-4-8-19)24(18-26)23(22)16-12-20-9-5-2-6-10-20/h1-16H/b13-11+,16-12+ |
| InChIKey | IMDVDXGKOJEWCP-PKRRCJCNSA-N |
| XLogP | 5.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|