C33H21N3 — CID 100941725
4-[(E)-2-[2,3-bis[(E)-2-(4-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile (PubChem CID 100941725) has the molecular formula C33H21N3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[(E)-2-[2,3-bis[(E)-2-(4-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[2,3-bis[(E)-2-(4-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 100941725 |
| Molecular Formula | C33H21N3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[(E)-2-[2,3-bis[(E)-2-(4-cyanophenyl)ethenyl]phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2cccc(/C=C/c3ccc(C#N)cc3)c2/C=C/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C33H21N3/c34-22-28-10-4-25(5-11-28)16-19-31-2-1-3-32(20-17-26-6-12-29(23-35)13-7-26)33(31)21-18-27-8-14-30(24-36)15-9-27/h1-21H/b19-16+,20-17+,21-18+ |
| InChIKey | VSSDETWVHRAKAS-VNQRMFGESA-N |
| XLogP | 7.81 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|