C48H34N4 — CID 102485481
4-[(E)-2-[4-[(E)-2-(4-cyanophenyl)ethenyl]-2,5-bis(N-phenylanilino)phenyl]ethenyl]benzonitrile (PubChem CID 102485481) has the molecular formula C48H34N4 and a molecular weight of 666.83 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(4-cyanophenyl)ethenyl]-2,5-bis(N-phenylanilino)phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[4-[(E)-2-(4-cyanophenyl)ethenyl]-2,5-bis(N-phenylanilino)phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 102485481 |
| Molecular Formula | C48H34N4 |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(4-cyanophenyl)ethenyl]-2,5-bis(N-phenylanilino)phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2cc(N(c3ccccc3)c3ccccc3)c(/C=C/c3ccc(C#N)cc3)cc2N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H34N4/c49-35-39-25-21-37(22-26-39)29-31-41-34-48(52(45-17-9-3-10-18-45)46-19-11-4-12-20-46)42(32-30-38-23-27-40(36-50)28-24-38)33-47(41)51(43-13-5-1-6-14-43)44-15-7-2-8-16-44/h1-34H/b31-29+,32-30+ |
| InChIKey | ZEDSZKKSDJTMNT-JWTBXLROSA-N |
| XLogP | 12.71 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|