C38H27N3 — CID 163921595
1-methyl-8-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]phenanthrene-3,6-dicarbonitrile (PubChem CID 163921595) has the molecular formula C38H27N3 and a molecular weight of 525.66 g/mol. Its IUPAC name is 1-methyl-8-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]phenanthrene-3,6-dicarbonitrile.
| Compound Name | 1-methyl-8-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]phenanthrene-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 163921595 |
| Molecular Formula | C38H27N3 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 1-methyl-8-[(E)-2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]phenanthrene-3,6-dicarbonitrile |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(/C=C/c3cc(C#N)cc4c3ccc3c(C)cc(C#N)cc34)cc2)cc1 |
| InChI | InChI=1S/C38H27N3/c1-26-8-14-33(15-9-26)41(32-6-4-3-5-7-32)34-16-11-28(12-17-34)10-13-31-21-30(25-40)23-38-36(31)19-18-35-27(2)20-29(24-39)22-37(35)38/h3-23H,1-2H3/b13-10+ |
| InChIKey | RAWCDZAPBSOWHZ-JLHYYAGUSA-N |
| XLogP | 9.99 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|