C31H21Br2N — CID 102018905
4-[(E)-2-[3,5-bis[(E)-2-(4-bromophenyl)ethenyl]phenyl]ethenyl]benzonitrile (PubChem CID 102018905) has the molecular formula C31H21Br2N and a molecular weight of 567.32 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis[(E)-2-(4-bromophenyl)ethenyl]phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[3,5-bis[(E)-2-(4-bromophenyl)ethenyl]phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 102018905 |
| Molecular Formula | C31H21Br2N |
| Molecular Weight | 567.32 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | 4-[(E)-2-[3,5-bis[(E)-2-(4-bromophenyl)ethenyl]phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2cc(/C=C/c3ccc(Br)cc3)cc(/C=C/c3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C31H21Br2N/c32-30-15-11-24(12-16-30)4-9-28-19-27(8-3-23-1-6-26(22-34)7-2-23)20-29(21-28)10-5-25-13-17-31(33)18-14-25/h1-21H/b8-3+,9-4+,10-5+ |
| InChIKey | VSESNKVKUNIONE-UMLZURHMSA-N |
| XLogP | 9.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.32 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|