C23H17Br2NS — CID 135221956
4-[1,3-bis(4-bromophenyl)prop-2-enylsulfanylmethyl]benzonitrile (PubChem CID 135221956) has the molecular formula C23H17Br2NS and a molecular weight of 499.27 g/mol. Its IUPAC name is 4-[1,3-bis(4-bromophenyl)prop-2-enylsulfanylmethyl]benzonitrile.
| Compound Name | 4-[1,3-bis(4-bromophenyl)prop-2-enylsulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 135221956 |
| Molecular Formula | C23H17Br2NS |
| Molecular Weight | 499.27 g/mol |
| Exact Mass | 496.94 |
| IUPAC Name | 4-[1,3-bis(4-bromophenyl)prop-2-enylsulfanylmethyl]benzonitrile |
| SMILES | N#Cc1ccc(CSC(C=Cc2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H17Br2NS/c24-21-10-5-17(6-11-21)7-14-23(20-8-12-22(25)13-9-20)27-16-19-3-1-18(15-26)2-4-19/h1-14,23H,16H2 |
| InChIKey | LTTOPTBJRWKEJO-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.27 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |