C23H19NO — CID 134938938
4-[(1R,2S)-1-hydroxy-2,4-diphenylbut-3-enyl]benzonitrile (PubChem CID 134938938) has the molecular formula C23H19NO and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[(1R,2S)-1-hydroxy-2,4-diphenylbut-3-enyl]benzonitrile.
| Compound Name | 4-[(1R,2S)-1-hydroxy-2,4-diphenylbut-3-enyl]benzonitrile |
|---|---|
| PubChem CID | 134938938 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-[(1R,2S)-1-hydroxy-2,4-diphenylbut-3-enyl]benzonitrile |
| SMILES | N#Cc1ccc([C@H](O)[C@@H](C=Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO/c24-17-19-11-14-21(15-12-19)23(25)22(20-9-5-2-6-10-20)16-13-18-7-3-1-4-8-18/h1-16,22-23,25H/t22-,23-/m0/s1 |
| InChIKey | ARTDXKYRUYQDJJ-GOTSBHOMSA-N |
| XLogP | 5.09 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |