C15H11Br2N — CID 13431601
4-(1,2-dibromo-2-phenylethyl)benzonitrile (PubChem CID 13431601) has the molecular formula C15H11Br2N and a molecular weight of 365.07 g/mol. Its IUPAC name is 4-(1,2-dibromo-2-phenylethyl)benzonitrile.
| Compound Name | 4-(1,2-dibromo-2-phenylethyl)benzonitrile |
|---|---|
| PubChem CID | 13431601 |
| Molecular Formula | C15H11Br2N |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | 4-(1,2-dibromo-2-phenylethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(Br)C(Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11Br2N/c16-14(12-4-2-1-3-5-12)15(17)13-8-6-11(10-18)7-9-13/h1-9,14-15H |
| InChIKey | UZVNDQIZNIXLNN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|