About 3-bromo-2,3-diphenylpropanenitrile
3-bromo-2,3-diphenylpropanenitrile (PubChem CID 14451941) has the molecular formula C15H12BrN
and a molecular weight of 286.17 g/mol. Its IUPAC name is 3-bromo-2,3-diphenylpropanenitrile.
Molecular Properties
| Compound Name | 3-bromo-2,3-diphenylpropanenitrile |
| PubChem CID | 14451941 |
| Molecular Formula | C15H12BrN |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-bromo-2,3-diphenylpropanenitrile |
| SMILES | N#CC(c1ccccc1)C(Br)c1ccccc1 |
| InChI | InChI=1S/C15H12BrN/c16-15(13-9-5-2-6-10-13)14(11-17)12-7-3-1-4-8-12/h1-10,14-15H |
| InChIKey | PPWOMNPZYRQTKZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,3-diphenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,3-diphenylpropanenitrile?
The IUPAC name of 3-bromo-2,3-diphenylpropanenitrile (CID 14451941) is 3-bromo-2,3-diphenylpropanenitrile.
What is the SMILES notation for 3-bromo-2,3-diphenylpropanenitrile?
The canonical SMILES for 3-bromo-2,3-diphenylpropanenitrile is N#CC(c1ccccc1)C(Br)c1ccccc1.
What is the InChIKey of 3-bromo-2,3-diphenylpropanenitrile?
The InChIKey is PPWOMNPZYRQTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrN/c16-15(13-9-5-2-6-10-13)14(11-17)12-7-3-1-4-8-12/h1-10,14-15H.
What are the key properties of 3-bromo-2,3-diphenylpropanenitrile?
3-bromo-2,3-diphenylpropanenitrile has a molecular weight of 286.17 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,3-diphenylpropanenitrile is sourced from PubChem (CID 14451941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).