C11H7N3S — CID 42107662
[(1R,2R)-1,2-dicyano-2-phenylethyl] thiocyanate (PubChem CID 42107662) has the molecular formula C11H7N3S and a molecular weight of 213.26 g/mol. Its IUPAC name is [(1R,2R)-1,2-dicyano-2-phenylethyl] thiocyanate.
| Compound Name | [(1R,2R)-1,2-dicyano-2-phenylethyl] thiocyanate |
|---|---|
| PubChem CID | 42107662 |
| Molecular Formula | C11H7N3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | [(1R,2R)-1,2-dicyano-2-phenylethyl] thiocyanate |
| SMILES | N#CS[C@@H](C#N)[C@@H](C#N)c1ccccc1 |
| InChI | InChI=1S/C11H7N3S/c12-6-10(11(7-13)15-8-14)9-4-2-1-3-5-9/h1-5,10-11H/t10-,11-/m0/s1 |
| InChIKey | FFDGJFFHPKCGCN-QWRGUYRKSA-N |
| XLogP | 2.40 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|