C13H14N2 — CID 19049764
2,4-dimethyl-3-phenylpentanedinitrile (PubChem CID 19049764) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2,4-dimethyl-3-phenylpentanedinitrile.
| Compound Name | 2,4-dimethyl-3-phenylpentanedinitrile |
|---|---|
| PubChem CID | 19049764 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2,4-dimethyl-3-phenylpentanedinitrile |
| SMILES | CC(C#N)C(c1ccccc1)C(C)C#N |
| InChI | InChI=1S/C13H14N2/c1-10(8-14)13(11(2)9-15)12-6-4-3-5-7-12/h3-7,10-11,13H,1-2H3 |
| InChIKey | BFPSUEDPDCXHMV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |