About acetonitrile;cumene
acetonitrile;cumene (PubChem CID 141203612) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is acetonitrile;cumene.
Molecular Properties
| Compound Name | acetonitrile;cumene |
| PubChem CID | 141203612 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | acetonitrile;cumene |
| SMILES | CC#N.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12.C2H3N/c1-8(2)9-6-4-3-5-7-9;1-2-3/h3-8H,1-2H3;1H3 |
| InChIKey | FKKWEYWMFOAGLW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetonitrile;cumene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;cumene?
The IUPAC name of acetonitrile;cumene (CID 141203612) is acetonitrile;cumene.
What is the SMILES notation for acetonitrile;cumene?
The canonical SMILES for acetonitrile;cumene is CC#N.CC(C)c1ccccc1.
What is the InChIKey of acetonitrile;cumene?
The InChIKey is FKKWEYWMFOAGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C2H3N/c1-8(2)9-6-4-3-5-7-9;1-2-3/h3-8H,1-2H3;1H3.
What are the key properties of acetonitrile;cumene?
acetonitrile;cumene has a molecular weight of 161.25 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;cumene is sourced from PubChem (CID 141203612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).