C14H19N — CID 153467297
2,5-dimethyl-4-phenylhexanenitrile (PubChem CID 153467297) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenylhexanenitrile.
| Compound Name | 2,5-dimethyl-4-phenylhexanenitrile |
|---|---|
| PubChem CID | 153467297 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,5-dimethyl-4-phenylhexanenitrile |
| SMILES | CC(C#N)CC(c1ccccc1)C(C)C |
| InChI | InChI=1S/C14H19N/c1-11(2)14(9-12(3)10-15)13-7-5-4-6-8-13/h4-8,11-12,14H,9H2,1-3H3 |
| InChIKey | SEGPFMRSSSMPBS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |