C13H18N2 — CID 102152439
(3S,4S)-4-(dimethylamino)-3-phenylpentanenitrile (PubChem CID 102152439) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3S,4S)-4-(dimethylamino)-3-phenylpentanenitrile.
| Compound Name | (3S,4S)-4-(dimethylamino)-3-phenylpentanenitrile |
|---|---|
| PubChem CID | 102152439 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (3S,4S)-4-(dimethylamino)-3-phenylpentanenitrile |
| SMILES | C[C@@H]([C@@H](CC#N)c1ccccc1)N(C)C |
| InChI | InChI=1S/C13H18N2/c1-11(15(2)3)13(9-10-14)12-7-5-4-6-8-12/h4-8,11,13H,9H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | BNJJDTZLWDXGQL-WCQYABFASA-N |
| XLogP | 2.63 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |