C19H19N3 — CID 101450206
(2S,3R)-2-[benzyl(methyl)amino]-3-phenylpentanedinitrile (PubChem CID 101450206) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S,3R)-2-[benzyl(methyl)amino]-3-phenylpentanedinitrile.
| Compound Name | (2S,3R)-2-[benzyl(methyl)amino]-3-phenylpentanedinitrile |
|---|---|
| PubChem CID | 101450206 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (2S,3R)-2-[benzyl(methyl)amino]-3-phenylpentanedinitrile |
| SMILES | CN(Cc1ccccc1)[C@H](C#N)[C@H](CC#N)c1ccccc1 |
| InChI | InChI=1S/C19H19N3/c1-22(15-16-8-4-2-5-9-16)19(14-21)18(12-13-20)17-10-6-3-7-11-17/h2-11,18-19H,12,15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | IGWJGLUNZGQYMN-RTBURBONSA-N |
| XLogP | 3.71 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |