C13H16N2O — CID 82113791
N-benzyl-3-cyano-N,2-dimethylpropanamide (PubChem CID 82113791) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-benzyl-3-cyano-N,2-dimethylpropanamide.
| Compound Name | N-benzyl-3-cyano-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 82113791 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-benzyl-3-cyano-N,2-dimethylpropanamide |
| SMILES | CC(CC#N)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c1-11(8-9-14)13(16)15(2)10-12-6-4-3-5-7-12/h3-7,11H,8,10H2,1-2H3 |
| InChIKey | RCXXZCCXBPEMOL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |