acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide

C18H21NO4 — CID 67863072

IUPACacetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide
SMILESCC(=O)O.CN(Cc1ccccc1)C(=O)C(O)c1ccccc1
InChIInChI=1S/C16H17NO2.C2H4O2/c1-17(12-13-8-4-2-5-9-13)16(19)15(18)14-10-6-3-7-11-14;1-2(3)4/h2-11,15,18H,12H2,1H3;1H3,(H,3,4)
InChIKeyIOIRACAGCUFNCD-UHFFFAOYSA-N
MW315.37 g/mol
LogP2.47
Rot. Bonds4

About acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide

acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide (PubChem CID 67863072) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide.

Molecular Properties

Compound Nameacetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide
PubChem CID67863072
Molecular FormulaC18H21NO4
Molecular Weight315.37 g/mol
Exact Mass315.15
IUPAC Nameacetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide
SMILESCC(=O)O.CN(Cc1ccccc1)C(=O)C(O)c1ccccc1
InChIInChI=1S/C16H17NO2.C2H4O2/c1-17(12-13-8-4-2-5-9-13)16(19)15(18)14-10-6-3-7-11-14;1-2(3)4/h2-11,15,18H,12H2,1H3;1H3,(H,3,4)
InChIKeyIOIRACAGCUFNCD-UHFFFAOYSA-N
XLogP2.47
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.37
LogP ≤ 52.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide?
The IUPAC name of acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide (CID 67863072) is acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide.
What is the SMILES notation for acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide?
The canonical SMILES for acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide is CC(=O)O.CN(Cc1ccccc1)C(=O)C(O)c1ccccc1.
What is the InChIKey of acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide?
The InChIKey is IOIRACAGCUFNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2.C2H4O2/c1-17(12-13-8-4-2-5-9-13)16(19)15(18)14-10-6-3-7-11-14;1-2(3)4/h2-11,15,18H,12H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide?
acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide has a molecular weight of 315.37 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-benzyl-2-hydroxy-N-methyl-2-phenylacetamide is sourced from PubChem (CID 67863072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).