C18H21NO3 — CID 11087866
(3R,4R)-N-benzyl-3,4-dihydroxy-N-methyl-4-phenylbutanamide (PubChem CID 11087866) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3R,4R)-N-benzyl-3,4-dihydroxy-N-methyl-4-phenylbutanamide.
| Compound Name | (3R,4R)-N-benzyl-3,4-dihydroxy-N-methyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 11087866 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3R,4R)-N-benzyl-3,4-dihydroxy-N-methyl-4-phenylbutanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C[C@@H](O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-19(13-14-8-4-2-5-9-14)17(21)12-16(20)18(22)15-10-6-3-7-11-15/h2-11,16,18,20,22H,12-13H2,1H3/t16-,18-/m1/s1 |
| InChIKey | YXHMWPLZXFFMSQ-SJLPKXTDSA-N |
| XLogP | 2.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |