C24H23NO2 — CID 163377697
N-benzyl-N-methyl-4-oxo-2,3-diphenylbutanamide (PubChem CID 163377697) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-oxo-2,3-diphenylbutanamide.
| Compound Name | N-benzyl-N-methyl-4-oxo-2,3-diphenylbutanamide |
|---|---|
| PubChem CID | 163377697 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-benzyl-N-methyl-4-oxo-2,3-diphenylbutanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(c1ccccc1)C(C=O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO2/c1-25(17-19-11-5-2-6-12-19)24(27)23(21-15-9-4-10-16-21)22(18-26)20-13-7-3-8-14-20/h2-16,18,22-23H,17H2,1H3 |
| InChIKey | WWHWDMJASPRJCU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|