C11H14N2O2 — CID 18618309
N-benzyl-2-formamido-N-methylacetamide (PubChem CID 18618309) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-benzyl-2-formamido-N-methylacetamide.
| Compound Name | N-benzyl-2-formamido-N-methylacetamide |
|---|---|
| PubChem CID | 18618309 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-benzyl-2-formamido-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CNC=O |
| InChI | InChI=1S/C11H14N2O2/c1-13(11(15)7-12-9-14)8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,14) |
| InChIKey | ZFNLYJSNIUPSQB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|