C25H30N4O4 — CID 166187022
1-N,2-N-bis[2-[benzyl(methyl)amino]-2-oxoethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 166187022) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-N,2-N-bis[2-[benzyl(methyl)amino]-2-oxoethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[2-[benzyl(methyl)amino]-2-oxoethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 166187022 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-N,2-N-bis[2-[benzyl(methyl)amino]-2-oxoethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)CNC(=O)C1CC1C(=O)NCC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H30N4O4/c1-28(16-18-9-5-3-6-10-18)22(30)14-26-24(32)20-13-21(20)25(33)27-15-23(31)29(2)17-19-11-7-4-8-12-19/h3-12,20-21H,13-17H2,1-2H3,(H,26,32)(H,27,33) |
| InChIKey | IDEJTAGOVOSGJW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |