C23H22ClNO — CID 43909696
N-[(4-chlorophenyl)methyl]-N-methyl-3,3-diphenylpropanamide (PubChem CID 43909696) has the molecular formula C23H22ClNO and a molecular weight of 363.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-methyl-3,3-diphenylpropanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-methyl-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 43909696 |
| Molecular Formula | C23H22ClNO |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-methyl-3,3-diphenylpropanamide |
| SMILES | CN(Cc1ccc(Cl)cc1)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClNO/c1-25(17-18-12-14-21(24)15-13-18)23(26)16-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,22H,16-17H2,1H3 |
| InChIKey | RLPDTFXKXBYYMR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |