C19H20ClN5O — CID 97264597
(3S)-N-benzyl-3-(4-chlorophenyl)-N-methyl-4-(tetrazol-1-yl)butanamide (PubChem CID 97264597) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is (3S)-N-benzyl-3-(4-chlorophenyl)-N-methyl-4-(tetrazol-1-yl)butanamide.
| Compound Name | (3S)-N-benzyl-3-(4-chlorophenyl)-N-methyl-4-(tetrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 97264597 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (3S)-N-benzyl-3-(4-chlorophenyl)-N-methyl-4-(tetrazol-1-yl)butanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C[C@H](Cn1cnnn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN5O/c1-24(12-15-5-3-2-4-6-15)19(26)11-17(13-25-14-21-22-23-25)16-7-9-18(20)10-8-16/h2-10,14,17H,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | ALIUKVQGAOCCHU-QGZVFWFLSA-N |
| XLogP | 3.16 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |