C23H27ClN6O — CID 71709425
N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-(tetrazol-1-yl)butanamide (PubChem CID 71709425) has the molecular formula C23H27ClN6O and a molecular weight of 438.96 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-(tetrazol-1-yl)butanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-(tetrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 71709425 |
| Molecular Formula | C23H27ClN6O |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-(tetrazol-1-yl)butanamide |
| SMILES | O=C(CC(Cn1cnnn1)c1ccc(Cl)cc1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27ClN6O/c24-21-8-6-19(7-9-21)20(16-30-17-25-27-28-30)14-23(31)26-22-10-12-29(13-11-22)15-18-4-2-1-3-5-18/h1-9,17,20,22H,10-16H2,(H,26,31) |
| InChIKey | ZOCWTJDQGWXDMH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |