C26H30ClN3O — CID 71709557
N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-pyrrol-1-ylbutanamide (PubChem CID 71709557) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-pyrrol-1-ylbutanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 71709557 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)-4-pyrrol-1-ylbutanamide |
| SMILES | O=C(CC(Cn1cccc1)c1ccc(Cl)cc1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30ClN3O/c27-24-10-8-22(9-11-24)23(20-29-14-4-5-15-29)18-26(31)28-25-12-16-30(17-13-25)19-21-6-2-1-3-7-21/h1-11,14-15,23,25H,12-13,16-20H2,(H,28,31) |
| InChIKey | PMSKJKHKJAAQLS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |