C23H29ClN2OS — CID 2814922
N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)sulfanyl-3-methylbutanamide (PubChem CID 2814922) has the molecular formula C23H29ClN2OS and a molecular weight of 417.02 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)sulfanyl-3-methylbutanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 2814922 |
| Molecular Formula | C23H29ClN2OS |
| Molecular Weight | 417.02 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-(4-chlorophenyl)sulfanyl-3-methylbutanamide |
| SMILES | CC(C)(CC(=O)NC1CCN(Cc2ccccc2)CC1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN2OS/c1-23(2,28-21-10-8-19(24)9-11-21)16-22(27)25-20-12-14-26(15-13-20)17-18-6-4-3-5-7-18/h3-11,20H,12-17H2,1-2H3,(H,25,27) |
| InChIKey | XLTXTGHQOQMSHX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.02 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |