C20H29ClN4O2 — CID 55446686
N-(1-acetylpiperidin-4-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 55446686) has the molecular formula C20H29ClN4O2 and a molecular weight of 392.93 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55446686 |
| Molecular Formula | C20H29ClN4O2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | CC(=O)N1CCC(NC(=O)CN2CCN(Cc3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H29ClN4O2/c1-16(26)25-8-6-19(7-9-25)22-20(27)15-24-12-10-23(11-13-24)14-17-2-4-18(21)5-3-17/h2-5,19H,6-15H2,1H3,(H,22,27) |
| InChIKey | QNDHCUWFLXVCDG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |