C20H31ClN4O — CID 51636347
N-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-2-(4-ethylpiperazin-1-yl)acetamide (PubChem CID 51636347) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is N-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-2-(4-ethylpiperazin-1-yl)acetamide.
| Compound Name | N-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-2-(4-ethylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 51636347 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-[(3R)-1-[(4-chlorophenyl)methyl]piperidin-3-yl]-2-(4-ethylpiperazin-1-yl)acetamide |
| SMILES | CCN1CCN(CC(=O)N[C@@H]2CCCN(Cc3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C20H31ClN4O/c1-2-23-10-12-24(13-11-23)16-20(26)22-19-4-3-9-25(15-19)14-17-5-7-18(21)8-6-17/h5-8,19H,2-4,9-16H2,1H3,(H,22,26)/t19-/m1/s1 |
| InChIKey | XBHBWXCJKIAGTA-LJQANCHMSA-N |
| XLogP | 2.06 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |