C18H28ClN2O4P — CID 170164675
[1-[[1-[(4-chlorophenyl)methyl]piperidin-3-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid (PubChem CID 170164675) has the molecular formula C18H28ClN2O4P and a molecular weight of 402.86 g/mol. Its IUPAC name is [1-[[1-[(4-chlorophenyl)methyl]piperidin-3-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid.
| Compound Name | [1-[[1-[(4-chlorophenyl)methyl]piperidin-3-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 170164675 |
| Molecular Formula | C18H28ClN2O4P |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [1-[[1-[(4-chlorophenyl)methyl]piperidin-3-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
| SMILES | CC(C)CC(C(=O)NC1CCCN(Cc2ccc(Cl)cc2)C1)P(=O)(O)O |
| InChI | InChI=1S/C18H28ClN2O4P/c1-13(2)10-17(26(23,24)25)18(22)20-16-4-3-9-21(12-16)11-14-5-7-15(19)8-6-14/h5-8,13,16-17H,3-4,9-12H2,1-2H3,(H,20,22)(H2,23,24,25) |
| InChIKey | HQWRTYBHFDJPOV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|