C23H29ClN2O — CID 55428414
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(4-ethylphenyl)propanamide (PubChem CID 55428414) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(4-ethylphenyl)propanamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 55428414 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(CCC(=O)NC2CCN(Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H29ClN2O/c1-2-18-3-5-19(6-4-18)9-12-23(27)25-22-13-15-26(16-14-22)17-20-7-10-21(24)11-8-20/h3-8,10-11,22H,2,9,12-17H2,1H3,(H,25,27) |
| InChIKey | JNMAATRARZHQSD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |