C16H18ClF3N2O2 — CID 108556549
3-(4-chlorophenyl)-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide (PubChem CID 108556549) has the molecular formula C16H18ClF3N2O2 and a molecular weight of 362.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108556549 |
| Molecular Formula | C16H18ClF3N2O2 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)NC1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H18ClF3N2O2/c17-12-4-1-11(2-5-12)3-6-14(23)21-13-7-9-22(10-8-13)15(24)16(18,19)20/h1-2,4-5,13H,3,6-10H2,(H,21,23) |
| InChIKey | VUMFJNCCCQAOPB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |