C19H25ClN2O3 — CID 108556607
3-(4-chlorophenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]propanamide (PubChem CID 108556607) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108556607 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)NC1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H25ClN2O3/c20-15-6-3-14(4-7-15)5-8-18(23)21-16-9-11-22(12-10-16)19(24)17-2-1-13-25-17/h3-4,6-7,16-17H,1-2,5,8-13H2,(H,21,23) |
| InChIKey | MIZWWZCFCAJRGE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |