C18H23ClN2O3 — CID 108561805
N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]oxolane-2-carboxamide (PubChem CID 108561805) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]oxolane-2-carboxamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 108561805 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)acetyl]piperidin-4-yl]oxolane-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Cc2ccc(Cl)cc2)CC1)C1CCCO1 |
| InChI | InChI=1S/C18H23ClN2O3/c19-14-5-3-13(4-6-14)12-17(22)21-9-7-15(8-10-21)20-18(23)16-2-1-11-24-16/h3-6,15-16H,1-2,7-12H2,(H,20,23) |
| InChIKey | RHGVMEWBJKUPKY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |