C17H22ClN3O2S — CID 31427469
2-[4-[2-(4-chlorophenyl)sulfanylacetyl]piperazin-1-yl]-N-cyclopropylacetamide (PubChem CID 31427469) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenyl)sulfanylacetyl]piperazin-1-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[2-(4-chlorophenyl)sulfanylacetyl]piperazin-1-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 31427469 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[4-[2-(4-chlorophenyl)sulfanylacetyl]piperazin-1-yl]-N-cyclopropylacetamide |
| SMILES | O=C(CN1CCN(C(=O)CSc2ccc(Cl)cc2)CC1)NC1CC1 |
| InChI | InChI=1S/C17H22ClN3O2S/c18-13-1-5-15(6-2-13)24-12-17(23)21-9-7-20(8-10-21)11-16(22)19-14-3-4-14/h1-2,5-6,14H,3-4,7-12H2,(H,19,22) |
| InChIKey | KMFWUWNBEKCAAJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |