C16H15N — CID 57019380
3,4-diphenylbutanenitrile (PubChem CID 57019380) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,4-diphenylbutanenitrile.
| Compound Name | 3,4-diphenylbutanenitrile |
|---|---|
| PubChem CID | 57019380 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3,4-diphenylbutanenitrile |
| SMILES | N#CCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N/c17-12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,16H,11,13H2 |
| InChIKey | YXLSDQNDCLOXDK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |