C35H34 — CID 159042556
1,3-diphenylpropan-2-ylbenzene;2-phenylethylbenzene (PubChem CID 159042556) has the molecular formula C35H34 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-ylbenzene;2-phenylethylbenzene.
| Compound Name | 1,3-diphenylpropan-2-ylbenzene;2-phenylethylbenzene |
|---|---|
| PubChem CID | 159042556 |
| Molecular Formula | C35H34 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1,3-diphenylpropan-2-ylbenzene;2-phenylethylbenzene |
| SMILES | c1ccc(CC(Cc2ccccc2)c2ccccc2)cc1.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20.C14H14/c1-4-10-18(11-5-1)16-21(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-15,21H,16-17H2;1-10H,11-12H2 |
| InChIKey | JWGDJRKRALLXRN-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |