C21H22N+ — CID 23252346
4-(1,3-diphenylpropan-2-yl)-1-methylpyridin-1-ium (PubChem CID 23252346) has the molecular formula C21H22N+ and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-(1,3-diphenylpropan-2-yl)-1-methylpyridin-1-ium.
| Compound Name | 4-(1,3-diphenylpropan-2-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 23252346 |
| Molecular Formula | C21H22N+ |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 4-(1,3-diphenylpropan-2-yl)-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(C(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N/c1-22-14-12-20(13-15-22)21(16-18-8-4-2-5-9-18)17-19-10-6-3-7-11-19/h2-15,21H,16-17H2,1H3/q+1 |
| InChIKey | LJHUJTMXFLBHPT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|