C12H15ClN2 — CID 11299023
2-[[(1R,2S)-1-chloro-1-phenylpropan-2-yl]-methylamino]acetonitrile (PubChem CID 11299023) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-[[(1R,2S)-1-chloro-1-phenylpropan-2-yl]-methylamino]acetonitrile.
| Compound Name | 2-[[(1R,2S)-1-chloro-1-phenylpropan-2-yl]-methylamino]acetonitrile |
|---|---|
| PubChem CID | 11299023 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-[[(1R,2S)-1-chloro-1-phenylpropan-2-yl]-methylamino]acetonitrile |
| SMILES | C[C@@H]([C@H](Cl)c1ccccc1)N(C)CC#N |
| InChI | InChI=1S/C12H15ClN2/c1-10(15(2)9-8-14)12(13)11-6-4-3-5-7-11/h3-7,10,12H,9H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | WMXKOAWAUMCFIF-JQWIXIFHSA-N |
| XLogP | 2.81 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|