C12H17Cl2N — CID 23261492
(1R,2R)-1-chloro-N-(2-chloroethyl)-N-methyl-1-phenylpropan-2-amine (PubChem CID 23261492) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is (1R,2R)-1-chloro-N-(2-chloroethyl)-N-methyl-1-phenylpropan-2-amine.
| Compound Name | (1R,2R)-1-chloro-N-(2-chloroethyl)-N-methyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 23261492 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (1R,2R)-1-chloro-N-(2-chloroethyl)-N-methyl-1-phenylpropan-2-amine |
| SMILES | C[C@H]([C@H](Cl)c1ccccc1)N(C)CCCl |
| InChI | InChI=1S/C12H17Cl2N/c1-10(15(2)9-8-13)12(14)11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | VXSUWEMWCLTDTA-PWSUYJOCSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|