C12H16Cl2 — CID 174512568
(1,5-dichloro-2-methylpentyl)benzene (PubChem CID 174512568) has the molecular formula C12H16Cl2 and a molecular weight of 231.17 g/mol. Its IUPAC name is (1,5-dichloro-2-methylpentyl)benzene.
| Compound Name | (1,5-dichloro-2-methylpentyl)benzene |
|---|---|
| PubChem CID | 174512568 |
| Molecular Formula | C12H16Cl2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (1,5-dichloro-2-methylpentyl)benzene |
| SMILES | CC(CCCCl)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H16Cl2/c1-10(6-5-9-13)12(14)11-7-3-2-4-8-11/h2-4,7-8,10,12H,5-6,9H2,1H3 |
| InChIKey | PMMVCGQFCBJBRB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|