C12H18Cl3N — CID 138396559
N,N-bis(2-chloroethyl)-1-phenylethanamine;hydrochloride (PubChem CID 138396559) has the molecular formula C12H18Cl3N and a molecular weight of 282.64 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-1-phenylethanamine;hydrochloride.
| Compound Name | N,N-bis(2-chloroethyl)-1-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 138396559 |
| Molecular Formula | C12H18Cl3N |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N,N-bis(2-chloroethyl)-1-phenylethanamine;hydrochloride |
| SMILES | CC(c1ccccc1)N(CCCl)CCCl.Cl |
| InChI | InChI=1S/C12H17Cl2N.ClH/c1-11(12-5-3-2-4-6-12)15(9-7-13)10-8-14;/h2-6,11H,7-10H2,1H3;1H |
| InChIKey | NVFRRXNOTODTTJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|